C15H12N4O6 — CID 46201932
5-(3,4-dimethoxy-5-nitrophenyl)-3-(1-oxidopyridin-1-ium-3-yl)-1,2,4-oxadiazole (PubChem CID 46201932) has the molecular formula C15H12N4O6 and a molecular weight of 344.28 g/mol. Its IUPAC name is 5-(3,4-dimethoxy-5-nitrophenyl)-3-(1-oxidopyridin-1-ium-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(3,4-dimethoxy-5-nitrophenyl)-3-(1-oxidopyridin-1-ium-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46201932 |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-(3,4-dimethoxy-5-nitrophenyl)-3-(1-oxidopyridin-1-ium-3-yl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2nc(-c3ccc[n+]([O-])c3)no2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C15H12N4O6/c1-23-12-7-10(6-11(19(21)22)13(12)24-2)15-16-14(17-25-15)9-4-3-5-18(20)8-9/h3-8H,1-2H3 |
| InChIKey | IJEPUUAKJZZCKM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 127.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|