C27H19ClN4O6 — CID 46201934
3-(2-chloro-1-oxidopyridin-1-ium-3-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 46201934) has the molecular formula C27H19ClN4O6 and a molecular weight of 530.92 g/mol. Its IUPAC name is 3-(2-chloro-1-oxidopyridin-1-ium-3-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2-chloro-1-oxidopyridin-1-ium-3-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46201934 |
| Molecular Formula | C27H19ClN4O6 |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 3-(2-chloro-1-oxidopyridin-1-ium-3-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccc[n+]([O-])c3Cl)no2)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H19ClN4O6/c28-25-21(12-7-13-31(25)33)26-29-27(38-30-26)20-14-22(32(34)35)24(37-17-19-10-5-2-6-11-19)23(15-20)36-16-18-8-3-1-4-9-18/h1-15H,16-17H2 |
| InChIKey | AFUZSGYVOAEZOS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 127.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|