C28H21F3N2O6 — CID 67036859
1-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]ethanone (PubChem CID 67036859) has the molecular formula C28H21F3N2O6 and a molecular weight of 538.48 g/mol. Its IUPAC name is 1-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]ethanone.
| Compound Name | 1-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]ethanone |
|---|---|
| PubChem CID | 67036859 |
| Molecular Formula | C28H21F3N2O6 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 1-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]ethanone |
| SMILES | O=C(Cc1ccc[n+]([O-])c1C(F)(F)F)c1cc(OCc2ccccc2)c(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H21F3N2O6/c29-28(30,31)27-21(12-7-13-32(27)35)15-24(34)22-14-23(33(36)37)26(39-18-20-10-5-2-6-11-20)25(16-22)38-17-19-8-3-1-4-9-19/h1-14,16H,15,17-18H2 |
| InChIKey | QJLQXKLQGYKYQR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|