C33H33NO7 — CID 19777441
3-[6-[2,3-bis(phenylmethoxy)phenyl]hexoxy]-4-nitrobenzoic acid (PubChem CID 19777441) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is 3-[6-[2,3-bis(phenylmethoxy)phenyl]hexoxy]-4-nitrobenzoic acid.
| Compound Name | 3-[6-[2,3-bis(phenylmethoxy)phenyl]hexoxy]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 19777441 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 3-[6-[2,3-bis(phenylmethoxy)phenyl]hexoxy]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(OCCCCCCc2cccc(OCc3ccccc3)c2OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H33NO7/c35-33(36)28-19-20-29(34(37)38)31(22-28)39-21-10-2-1-9-16-27-17-11-18-30(40-23-25-12-5-3-6-13-25)32(27)41-24-26-14-7-4-8-15-26/h3-8,11-15,17-20,22H,1-2,9-10,16,21,23-24H2,(H,35,36) |
| InChIKey | FYMXTUYKHRBCKP-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|