C14H8F3N4O6+ — CID 143797422
5-[3-[1-hydroxy-2-(trifluoromethyl)pyridin-1-ium-3-yl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 143797422) has the molecular formula C14H8F3N4O6+ and a molecular weight of 385.23 g/mol. Its IUPAC name is 5-[3-[1-hydroxy-2-(trifluoromethyl)pyridin-1-ium-3-yl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-[1-hydroxy-2-(trifluoromethyl)pyridin-1-ium-3-yl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 143797422 |
| Molecular Formula | C14H8F3N4O6+ |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 5-[3-[1-hydroxy-2-(trifluoromethyl)pyridin-1-ium-3-yl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccc[n+](O)c3C(F)(F)F)no2)cc(O)c1O |
| InChI | InChI=1S/C14H7F3N4O6/c15-14(16,17)11-7(2-1-3-20(11)24)12-18-13(27-19-12)6-4-8(21(25)26)10(23)9(22)5-6/h1-5H,(H2-,18,19,22,23,24)/p+1 |
| InChIKey | SGCGKXBEFJSZKJ-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|