C20H16F3N3O7 — CID 67036895
ethyl 5-(3,4-dihydroxy-5-nitrophenyl)-1-methyl-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrole-3-carboxylate (PubChem CID 67036895) has the molecular formula C20H16F3N3O7 and a molecular weight of 467.36 g/mol. Its IUPAC name is ethyl 5-(3,4-dihydroxy-5-nitrophenyl)-1-methyl-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(3,4-dihydroxy-5-nitrophenyl)-1-methyl-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 67036895 |
| Molecular Formula | C20H16F3N3O7 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | ethyl 5-(3,4-dihydroxy-5-nitrophenyl)-1-methyl-2-[1-oxido-2-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc(O)c(O)c([N+](=O)[O-])c2)n(C)c1-c1ccc[n+]([O-])c1C(F)(F)F |
| InChI | InChI=1S/C20H16F3N3O7/c1-3-33-19(29)12-9-13(10-7-14(26(31)32)17(28)15(27)8-10)24(2)16(12)11-5-4-6-25(30)18(11)20(21,22)23/h4-9,27-28H,3H2,1-2H3 |
| InChIKey | ZGPVZSVCUBQMJD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 141.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|