C24H18F3N3O5 — CID 67037045
5-[1-methyl-5-[6-methyl-1-oxido-2-phenyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrol-2-yl]-3-nitrobenzene-1,2-diol (PubChem CID 67037045) has the molecular formula C24H18F3N3O5 and a molecular weight of 485.42 g/mol. Its IUPAC name is 5-[1-methyl-5-[6-methyl-1-oxido-2-phenyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrol-2-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[1-methyl-5-[6-methyl-1-oxido-2-phenyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrol-2-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 67037045 |
| Molecular Formula | C24H18F3N3O5 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 5-[1-methyl-5-[6-methyl-1-oxido-2-phenyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]pyrrol-2-yl]-3-nitrobenzene-1,2-diol |
| SMILES | Cc1cc(C(F)(F)F)c(-c2ccc(-c3cc(O)c(O)c([N+](=O)[O-])c3)n2C)c(-c2ccccc2)[n+]1[O-] |
| InChI | InChI=1S/C24H18F3N3O5/c1-13-10-16(24(25,26)27)21(22(29(13)33)14-6-4-3-5-7-14)18-9-8-17(28(18)2)15-11-19(30(34)35)23(32)20(31)12-15/h3-12,31-32H,1-2H3 |
| InChIKey | JQEIPSSRBPEFDC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|