C16H12BrN3O4 — CID 135894296
3-nitro-5-(2-phenylpyrimidin-4-yl)benzene-1,2-diol;hydrobromide (PubChem CID 135894296) has the molecular formula C16H12BrN3O4 and a molecular weight of 390.19 g/mol. Its IUPAC name is 3-nitro-5-(2-phenylpyrimidin-4-yl)benzene-1,2-diol;hydrobromide.
| Compound Name | 3-nitro-5-(2-phenylpyrimidin-4-yl)benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 135894296 |
| Molecular Formula | C16H12BrN3O4 |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 3-nitro-5-(2-phenylpyrimidin-4-yl)benzene-1,2-diol;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1cc(-c2ccnc(-c3ccccc3)n2)cc(O)c1O |
| InChI | InChI=1S/C16H11N3O4.BrH/c20-14-9-11(8-13(15(14)21)19(22)23)12-6-7-17-16(18-12)10-4-2-1-3-5-10;/h1-9,20-21H;1H |
| InChIKey | HFDFKCRIAMDHRV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|