C9H7N3O4 — CID 135923285
3-nitro-5-(1H-pyrazol-5-yl)benzene-1,2-diol (PubChem CID 135923285) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 3-nitro-5-(1H-pyrazol-5-yl)benzene-1,2-diol.
| Compound Name | 3-nitro-5-(1H-pyrazol-5-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 135923285 |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-nitro-5-(1H-pyrazol-5-yl)benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2ccn[nH]2)cc(O)c1O |
| InChI | InChI=1S/C9H7N3O4/c13-8-4-5(6-1-2-10-11-6)3-7(9(8)14)12(15)16/h1-4,13-14H,(H,10,11) |
| InChIKey | BDMGTPPAYPRUGZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|