C13H9N5O5 — CID 142496916
5-[2-(4-hydroxyphenyl)tetrazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 142496916) has the molecular formula C13H9N5O5 and a molecular weight of 315.25 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)tetrazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[2-(4-hydroxyphenyl)tetrazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 142496916 |
| Molecular Formula | C13H9N5O5 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)tetrazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2nnn(-c3ccc(O)cc3)n2)cc(O)c1O |
| InChI | InChI=1S/C13H9N5O5/c19-9-3-1-8(2-4-9)17-15-13(14-16-17)7-5-10(18(22)23)12(21)11(20)6-7/h1-6,19-21H |
| InChIKey | RNNIDKVCJYIUIP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|