C17H15N5O5 — CID 9196152
1-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-3-nitrophenyl]ethanone (PubChem CID 9196152) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 9196152 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[4-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]-3-nitrophenyl]ethanone |
| SMILES | COc1ccc(-c2nnn(-c3ccc(C(C)=O)cc3[N+](=O)[O-])n2)cc1OC |
| InChI | InChI=1S/C17H15N5O5/c1-10(23)11-4-6-13(14(8-11)22(24)25)21-19-17(18-20-21)12-5-7-15(26-2)16(9-12)27-3/h4-9H,1-3H3 |
| InChIKey | ADNHLNFDGSSODU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|