C14H9FN4O5 — CID 142496792
5-[5-(4-fluoro-3-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]-3-nitrobenzene-1,2-diol (PubChem CID 142496792) has the molecular formula C14H9FN4O5 and a molecular weight of 332.25 g/mol. Its IUPAC name is 5-[5-(4-fluoro-3-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[5-(4-fluoro-3-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 142496792 |
| Molecular Formula | C14H9FN4O5 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 5-[5-(4-fluoro-3-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2n[nH]c(-c3ccc(F)c(O)c3)n2)cc(O)c1O |
| InChI | InChI=1S/C14H9FN4O5/c15-8-2-1-6(4-10(8)20)13-16-14(18-17-13)7-3-9(19(23)24)12(22)11(21)5-7/h1-5,20-22H,(H,16,17,18) |
| InChIKey | VDFPDYCNVNXXLP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|