C13H8N4O6 — CID 142497013
5-[3-(5-hydroxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 142497013) has the molecular formula C13H8N4O6 and a molecular weight of 316.23 g/mol. Its IUPAC name is 5-[3-(5-hydroxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-(5-hydroxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 142497013 |
| Molecular Formula | C13H8N4O6 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-[3-(5-hydroxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3cncc(O)c3)no2)cc(O)c1O |
| InChI | InChI=1S/C13H8N4O6/c18-8-1-7(4-14-5-8)12-15-13(23-16-12)6-2-9(17(21)22)11(20)10(19)3-6/h1-5,18-20H |
| InChIKey | BAKBMDRFFALYCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|