C13H8N4O4 — CID 67026095
2-nitro-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 67026095) has the molecular formula C13H8N4O4 and a molecular weight of 284.23 g/mol. Its IUPAC name is 2-nitro-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenol.
| Compound Name | 2-nitro-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenol |
|---|---|
| PubChem CID | 67026095 |
| Molecular Formula | C13H8N4O4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-nitro-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3cccnc3)no2)cc1O |
| InChI | InChI=1S/C13H8N4O4/c18-11-6-8(3-4-10(11)17(19)20)13-15-12(16-21-13)9-2-1-5-14-7-9/h1-7,18H |
| InChIKey | VAWYCWJBAASKJX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|