C23H21N5O4 — CID 46264983
N-ethyl-N-[(4-methoxyphenyl)methyl]-2-nitro-4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 46264983) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-ethyl-N-[(4-methoxyphenyl)methyl]-2-nitro-4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | N-ethyl-N-[(4-methoxyphenyl)methyl]-2-nitro-4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 46264983 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-ethyl-N-[(4-methoxyphenyl)methyl]-2-nitro-4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | CCN(Cc1ccc(OC)cc1)c1ccc(-c2nc(-c3cccnc3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N5O4/c1-3-27(15-16-6-9-19(31-2)10-7-16)20-11-8-17(13-21(20)28(29)30)23-25-22(26-32-23)18-5-4-12-24-14-18/h4-14H,3,15H2,1-2H3 |
| InChIKey | NKSIREKTLXZYOG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|