C15H9N3O3 — CID 161188406
5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-1-benzofuran-2-one (PubChem CID 161188406) has the molecular formula C15H9N3O3 and a molecular weight of 279.25 g/mol. Its IUPAC name is 5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-1-benzofuran-2-one.
| Compound Name | 5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 161188406 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2cc(-c3nc(-c4cccnc4)no3)ccc2O1 |
| InChI | InChI=1S/C15H9N3O3/c19-13-7-11-6-9(3-4-12(11)20-13)15-17-14(18-21-15)10-2-1-5-16-8-10/h1-6,8H,7H2 |
| InChIKey | UTJVGUQVXLXOHQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|