C16H11N3O5 — CID 170027727
2,2-dihydroxy-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one (PubChem CID 170027727) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2,2-dihydroxy-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one.
| Compound Name | 2,2-dihydroxy-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 170027727 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2,2-dihydroxy-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one |
| SMILES | O=C1CC(O)(O)Oc2ccc(-c3nc(-c4cccnc4)no3)cc21 |
| InChI | InChI=1S/C16H11N3O5/c20-12-7-16(21,22)23-13-4-3-9(6-11(12)13)15-18-14(19-24-15)10-2-1-5-17-8-10/h1-6,8,21-22H,7H2 |
| InChIKey | LRVKCFCOEFXEAM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|