C18H13N3O7S — CID 142496844
3-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]-1-benzothiophene-5,6-diol (PubChem CID 142496844) has the molecular formula C18H13N3O7S and a molecular weight of 415.38 g/mol. Its IUPAC name is 3-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]-1-benzothiophene-5,6-diol.
| Compound Name | 3-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]-1-benzothiophene-5,6-diol |
|---|---|
| PubChem CID | 142496844 |
| Molecular Formula | C18H13N3O7S |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]-1-benzothiophene-5,6-diol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(CCc3csc4cc(O)c(O)cc34)no2)cc(O)c1O |
| InChI | InChI=1S/C18H13N3O7S/c22-12-5-10-8(7-29-15(10)6-13(12)23)1-2-16-19-18(28-20-16)9-3-11(21(26)27)17(25)14(24)4-9/h3-7,22-25H,1-2H2 |
| InChIKey | UTGBUPWYAYYCOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|