C21H13F3N4O6 — CID 136628039
5-[3-[2-methoxy-6-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 136628039) has the molecular formula C21H13F3N4O6 and a molecular weight of 474.35 g/mol. Its IUPAC name is 5-[3-[2-methoxy-6-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-[2-methoxy-6-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 136628039 |
| Molecular Formula | C21H13F3N4O6 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 5-[3-[2-methoxy-6-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | COc1nc(-c2ccccc2)cc(C(F)(F)F)c1-c1noc(-c2cc(O)c(O)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H13F3N4O6/c1-33-20-16(12(21(22,23)24)9-13(25-20)10-5-3-2-4-6-10)18-26-19(34-27-18)11-7-14(28(31)32)17(30)15(29)8-11/h2-9,29-30H,1H3 |
| InChIKey | HCXHWTVFAVPSKV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|