C22H14F3N3O4S — CID 68699356
5-[2-[6-methyl-2-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]-3-nitrobenzene-1,2-diol (PubChem CID 68699356) has the molecular formula C22H14F3N3O4S and a molecular weight of 473.43 g/mol. Its IUPAC name is 5-[2-[6-methyl-2-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[2-[6-methyl-2-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 68699356 |
| Molecular Formula | C22H14F3N3O4S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 5-[2-[6-methyl-2-phenyl-4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]-3-nitrobenzene-1,2-diol |
| SMILES | Cc1cc(C(F)(F)F)c(-c2nc(-c3cc(O)c(O)c([N+](=O)[O-])c3)cs2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H14F3N3O4S/c1-11-7-14(22(23,24)25)18(19(26-11)12-5-3-2-4-6-12)21-27-15(10-33-21)13-8-16(28(31)32)20(30)17(29)9-13/h2-10,29-30H,1H3 |
| InChIKey | NRIWFZYSWDEGNW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|