C14H8Cl2N4O5 — CID 67037106
5-[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)imidazol-4-yl]-3-nitrobenzene-1,2-diol (PubChem CID 67037106) has the molecular formula C14H8Cl2N4O5 and a molecular weight of 383.15 g/mol. Its IUPAC name is 5-[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)imidazol-4-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)imidazol-4-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 67037106 |
| Molecular Formula | C14H8Cl2N4O5 |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 5-[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)imidazol-4-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2cncn2-c2c(Cl)c[n+]([O-])cc2Cl)cc(O)c1O |
| InChI | InChI=1S/C14H8Cl2N4O5/c15-8-4-18(23)5-9(16)13(8)19-6-17-3-11(19)7-1-10(20(24)25)14(22)12(21)2-7/h1-6,21-22H |
| InChIKey | OXQBXZMBSYIPPN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|