C16H9F3N2O6 — CID 67037023
3-nitro-5-[5-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]furan-3-yl]benzene-1,2-diol (PubChem CID 67037023) has the molecular formula C16H9F3N2O6 and a molecular weight of 382.25 g/mol. Its IUPAC name is 3-nitro-5-[5-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]furan-3-yl]benzene-1,2-diol.
| Compound Name | 3-nitro-5-[5-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]furan-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67037023 |
| Molecular Formula | C16H9F3N2O6 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-nitro-5-[5-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]furan-3-yl]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2coc(-c3cc(C(F)(F)F)c[n+]([O-])c3)c2)cc(O)c1O |
| InChI | InChI=1S/C16H9F3N2O6/c17-16(18,19)11-1-9(5-20(24)6-11)14-4-10(7-27-14)8-2-12(21(25)26)15(23)13(22)3-8/h1-7,22-23H |
| InChIKey | ZGLDJQXIXSIROH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|