C19H16N4O9 — CID 45047891
ethyl 2-methylquinoline-3-carboxylate;2,4,6-trinitrophenol (PubChem CID 45047891) has the molecular formula C19H16N4O9 and a molecular weight of 444.36 g/mol. Its IUPAC name is ethyl 2-methylquinoline-3-carboxylate;2,4,6-trinitrophenol.
| Compound Name | ethyl 2-methylquinoline-3-carboxylate;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 45047891 |
| Molecular Formula | C19H16N4O9 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | ethyl 2-methylquinoline-3-carboxylate;2,4,6-trinitrophenol |
| SMILES | CCOC(=O)c1cc2ccccc2nc1C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13NO2.C6H3N3O7/c1-3-16-13(15)11-8-10-6-4-5-7-12(10)14-9(11)2;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h4-8H,3H2,1-2H3;1-2,10H |
| InChIKey | RKCAMWCAWNFKEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 188.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|