C24H21N3O4 — CID 162504727
1-methyl-5-[2-nitro-4,5-bis(phenylmethoxy)phenyl]pyrazole (PubChem CID 162504727) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-methyl-5-[2-nitro-4,5-bis(phenylmethoxy)phenyl]pyrazole.
| Compound Name | 1-methyl-5-[2-nitro-4,5-bis(phenylmethoxy)phenyl]pyrazole |
|---|---|
| PubChem CID | 162504727 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-methyl-5-[2-nitro-4,5-bis(phenylmethoxy)phenyl]pyrazole |
| SMILES | Cn1nccc1-c1cc(OCc2ccccc2)c(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N3O4/c1-26-21(12-13-25-26)20-14-23(30-16-18-8-4-2-5-9-18)24(15-22(20)27(28)29)31-17-19-10-6-3-7-11-19/h2-15H,16-17H2,1H3 |
| InChIKey | VRLGENPKGDVCCD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|