C15H15N3O5 — CID 3356129
N,N-dimethyl-2,4-dinitro-5-phenylmethoxyaniline (PubChem CID 3356129) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is N,N-dimethyl-2,4-dinitro-5-phenylmethoxyaniline.
| Compound Name | N,N-dimethyl-2,4-dinitro-5-phenylmethoxyaniline |
|---|---|
| PubChem CID | 3356129 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N,N-dimethyl-2,4-dinitro-5-phenylmethoxyaniline |
| SMILES | CN(C)c1cc(OCc2ccccc2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O5/c1-16(2)12-9-15(23-10-11-6-4-3-5-7-11)14(18(21)22)8-13(12)17(19)20/h3-9H,10H2,1-2H3 |
| InChIKey | SJJDOARZWNQBTF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|