C24H23N3O6 — CID 110529978
5,6-dimethoxy-2-[3-methoxy-4-[(2-methylphenyl)methoxy]-5-nitrophenyl]-1H-benzimidazole (PubChem CID 110529978) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[3-methoxy-4-[(2-methylphenyl)methoxy]-5-nitrophenyl]-1H-benzimidazole.
| Compound Name | 5,6-dimethoxy-2-[3-methoxy-4-[(2-methylphenyl)methoxy]-5-nitrophenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 110529978 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5,6-dimethoxy-2-[3-methoxy-4-[(2-methylphenyl)methoxy]-5-nitrophenyl]-1H-benzimidazole |
| SMILES | COc1cc2nc(-c3cc(OC)c(OCc4ccccc4C)c([N+](=O)[O-])c3)[nH]c2cc1OC |
| InChI | InChI=1S/C24H23N3O6/c1-14-7-5-6-8-15(14)13-33-23-19(27(28)29)9-16(10-22(23)32-4)24-25-17-11-20(30-2)21(31-3)12-18(17)26-24/h5-12H,13H2,1-4H3,(H,25,26) |
| InChIKey | CZEPETAFWFBCTK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|