C21H25N3O5 — CID 110532489
2-(4-hexoxy-3-methoxy-5-nitrophenyl)-6-methoxy-1H-benzimidazole (PubChem CID 110532489) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(4-hexoxy-3-methoxy-5-nitrophenyl)-6-methoxy-1H-benzimidazole.
| Compound Name | 2-(4-hexoxy-3-methoxy-5-nitrophenyl)-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 110532489 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-(4-hexoxy-3-methoxy-5-nitrophenyl)-6-methoxy-1H-benzimidazole |
| SMILES | CCCCCCOc1c(OC)cc(-c2nc3ccc(OC)cc3[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N3O5/c1-4-5-6-7-10-29-20-18(24(25)26)11-14(12-19(20)28-3)21-22-16-9-8-15(27-2)13-17(16)23-21/h8-9,11-13H,4-7,10H2,1-3H3,(H,22,23) |
| InChIKey | MCMWEBMWMDTJTN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|