C11H9ClN2O4 — CID 82571494
1-chloro-5,6-dimethoxy-8-nitroisoquinoline (PubChem CID 82571494) has the molecular formula C11H9ClN2O4 and a molecular weight of 268.66 g/mol. Its IUPAC name is 1-chloro-5,6-dimethoxy-8-nitroisoquinoline.
| Compound Name | 1-chloro-5,6-dimethoxy-8-nitroisoquinoline |
|---|---|
| PubChem CID | 82571494 |
| Molecular Formula | C11H9ClN2O4 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-chloro-5,6-dimethoxy-8-nitroisoquinoline |
| SMILES | COc1cc([N+](=O)[O-])c2c(Cl)nccc2c1OC |
| InChI | InChI=1S/C11H9ClN2O4/c1-17-8-5-7(14(15)16)9-6(10(8)18-2)3-4-13-11(9)12/h3-5H,1-2H3 |
| InChIKey | ILKOAMHCYURIBC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|