C8H8FN3O3S — CID 130221894
6-fluoro-3-[(sulfamoylamino)methyl]-1,2-benzoxazole (PubChem CID 130221894) has the molecular formula C8H8FN3O3S and a molecular weight of 245.23 g/mol. Its IUPAC name is 6-fluoro-3-[(sulfamoylamino)methyl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[(sulfamoylamino)methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 130221894 |
| Molecular Formula | C8H8FN3O3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 6-fluoro-3-[(sulfamoylamino)methyl]-1,2-benzoxazole |
| SMILES | NS(=O)(=O)NCc1noc2cc(F)ccc12 |
| InChI | InChI=1S/C8H8FN3O3S/c9-5-1-2-6-7(4-11-16(10,13)14)12-15-8(6)3-5/h1-3,11H,4H2,(H2,10,13,14) |
| InChIKey | ITWJUCJDYWELBB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |