C14H11ClN2O2S — CID 12631887
[1,2-benzoxazol-3-yl(chloro)methyl]-imino-oxo-phenyl-λ6-sulfane (PubChem CID 12631887) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is [1,2-benzoxazol-3-yl(chloro)methyl]-imino-oxo-phenyl-λ6-sulfane.
| Compound Name | [1,2-benzoxazol-3-yl(chloro)methyl]-imino-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 12631887 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [1,2-benzoxazol-3-yl(chloro)methyl]-imino-oxo-phenyl-λ6-sulfane |
| SMILES | [H]N=S(=O)(c1ccccc1)C(Cl)c1noc2ccccc12 |
| InChI | InChI=1S/C14H11ClN2O2S/c15-14(20(16,18)10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)19-17-13/h1-9,14,16H |
| InChIKey | TYNDRAYDGZTIFW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|