C29H28N2O — CID 150059098
1,5-bis(4-methylphenyl)-2,4-dipyridin-4-ylpentan-3-one (PubChem CID 150059098) has the molecular formula C29H28N2O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1,5-bis(4-methylphenyl)-2,4-dipyridin-4-ylpentan-3-one.
| Compound Name | 1,5-bis(4-methylphenyl)-2,4-dipyridin-4-ylpentan-3-one |
|---|---|
| PubChem CID | 150059098 |
| Molecular Formula | C29H28N2O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1,5-bis(4-methylphenyl)-2,4-dipyridin-4-ylpentan-3-one |
| SMILES | Cc1ccc(CC(C(=O)C(Cc2ccc(C)cc2)c2ccncc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C29H28N2O/c1-21-3-7-23(8-4-21)19-27(25-11-15-30-16-12-25)29(32)28(26-13-17-31-18-14-26)20-24-9-5-22(2)6-10-24/h3-18,27-28H,19-20H2,1-2H3 |
| InChIKey | DMXPMWDRPZHECH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |