C17H20N2O3 — CID 12722073
3-(3,4-dimethoxyphenyl)-2-phenylpropanehydrazide (PubChem CID 12722073) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-phenylpropanehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-phenylpropanehydrazide |
|---|---|
| PubChem CID | 12722073 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-phenylpropanehydrazide |
| SMILES | COc1ccc(CC(C(=O)NN)c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H20N2O3/c1-21-15-9-8-12(11-16(15)22-2)10-14(17(20)19-18)13-6-4-3-5-7-13/h3-9,11,14H,10,18H2,1-2H3,(H,19,20) |
| InChIKey | VIADGOQUNAHANB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|