C23H25N2O4P — CID 3615118
3-(3,4-dimethoxyphenyl)-2-diphenylphosphorylpropanehydrazide (PubChem CID 3615118) has the molecular formula C23H25N2O4P and a molecular weight of 424.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-diphenylphosphorylpropanehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-diphenylphosphorylpropanehydrazide |
|---|---|
| PubChem CID | 3615118 |
| Molecular Formula | C23H25N2O4P |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-diphenylphosphorylpropanehydrazide |
| SMILES | COc1ccc(CC(C(=O)NN)P(=O)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H25N2O4P/c1-28-20-14-13-17(15-21(20)29-2)16-22(23(26)25-24)30(27,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,22H,16,24H2,1-2H3,(H,25,26) |
| InChIKey | ZGLDKHKBJMMNDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|