C18H18N2OS — CID 951509
(2S)-N-[4-(cyanomethyl)phenyl]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 951509) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (2S)-N-[4-(cyanomethyl)phenyl]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 951509 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)Nc2ccc(CC#N)cc2)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-13-3-9-17(10-4-13)22-14(2)18(21)20-16-7-5-15(6-8-16)11-12-19/h3-10,14H,11H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | JNKBYOCSDHYLII-AWEZNQCLSA-N |
| XLogP | 4.18 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |