C20H21N3O2S — CID 9260795
(2S)-N-[4-(cyanomethyl)phenyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 9260795) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2S)-N-[4-(cyanomethyl)phenyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9260795 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2S)-N-[4-(cyanomethyl)phenyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=O)CS[C@@H](C)C(=O)Nc2ccc(CC#N)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-14-3-7-17(8-4-14)22-19(24)13-26-15(2)20(25)23-18-9-5-16(6-10-18)11-12-21/h3-10,15H,11,13H2,1-2H3,(H,22,24)(H,23,25)/t15-/m0/s1 |
| InChIKey | JHQFZMRMWHNNLD-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |