C16H13Cl4NO2S — CID 2252645
4-methoxy-N-[(1S)-2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]benzamide (PubChem CID 2252645) has the molecular formula C16H13Cl4NO2S and a molecular weight of 425.16 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1S)-2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 2252645 |
| Molecular Formula | C16H13Cl4NO2S |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 4-methoxy-N-[(1S)-2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](Sc2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13Cl4NO2S/c1-23-12-6-2-10(3-7-12)14(22)21-15(16(18,19)20)24-13-8-4-11(17)5-9-13/h2-9,15H,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | MRIRDTYIRGDISF-HNNXBMFYSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|