C11H11Cl4NO2S — CID 3089950
ethyl N-[2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate (PubChem CID 3089950) has the molecular formula C11H11Cl4NO2S and a molecular weight of 363.09 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 3089950 |
| Molecular Formula | C11H11Cl4NO2S |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate |
| SMILES | CCOC(=O)NC(Sc1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl4NO2S/c1-2-18-10(17)16-9(11(13,14)15)19-8-5-3-7(12)4-6-8/h3-6,9H,2H2,1H3,(H,16,17) |
| InChIKey | DPSNCVXUBMQVHE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|