C8H11Cl3N2O2S2 — CID 3823164
ethyl N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]carbamate (PubChem CID 3823164) has the molecular formula C8H11Cl3N2O2S2 and a molecular weight of 337.68 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 3823164 |
| Molecular Formula | C8H11Cl3N2O2S2 |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]carbamate |
| SMILES | CCOC(=O)NC(SC1=NCCS1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H11Cl3N2O2S2/c1-2-15-6(14)13-5(8(9,10)11)17-7-12-3-4-16-7/h5H,2-4H2,1H3,(H,13,14) |
| InChIKey | XWXKLHYUVREYOZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|