C18H16N2O2S2 — CID 1243092
N-[(1S)-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-oxo-2-phenylethyl]benzamide (PubChem CID 1243092) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(1S)-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-oxo-2-phenylethyl]benzamide.
| Compound Name | N-[(1S)-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-oxo-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 1243092 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[(1S)-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-oxo-2-phenylethyl]benzamide |
| SMILES | O=C(N[C@@H](SC1=NCCS1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S2/c21-15(13-7-3-1-4-8-13)17(24-18-19-11-12-23-18)20-16(22)14-9-5-2-6-10-14/h1-10,17H,11-12H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | KGXFWFGLFWRMQF-KRWDZBQOSA-N |
| XLogP | 3.46 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|