C13H11F6N3OS — CID 1046762
N-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide (PubChem CID 1046762) has the molecular formula C13H11F6N3OS and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide.
| Compound Name | N-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
|---|---|
| PubChem CID | 1046762 |
| Molecular Formula | C13H11F6N3OS |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| SMILES | O=C(NC(NC1=NCCS1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H11F6N3OS/c14-12(15,16)11(13(17,18)19,22-10-20-6-7-24-10)21-9(23)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,20,22)(H,21,23) |
| InChIKey | HVJCKZFDHJNLPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|