C11H9F3N2OS — CID 2676785
N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 2676785) has the molecular formula C11H9F3N2OS and a molecular weight of 274.27 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2676785 |
| Molecular Formula | C11H9F3N2OS |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N2OS/c12-11(13,14)8-3-1-2-7(6-8)9(17)16-10-15-4-5-18-10/h1-3,6H,4-5H2,(H,15,16,17) |
| InChIKey | JFTNBMCRGVAGAE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |