C10H12Cl3N3O2S — CID 2132794
ethyl N-[(1R)-2,2,2-trichloro-1-(6-methylpyrimidin-4-yl)sulfanylethyl]carbamate (PubChem CID 2132794) has the molecular formula C10H12Cl3N3O2S and a molecular weight of 344.65 g/mol. Its IUPAC name is ethyl N-[(1R)-2,2,2-trichloro-1-(6-methylpyrimidin-4-yl)sulfanylethyl]carbamate.
| Compound Name | ethyl N-[(1R)-2,2,2-trichloro-1-(6-methylpyrimidin-4-yl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 2132794 |
| Molecular Formula | C10H12Cl3N3O2S |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | ethyl N-[(1R)-2,2,2-trichloro-1-(6-methylpyrimidin-4-yl)sulfanylethyl]carbamate |
| SMILES | CCOC(=O)N[C@H](Sc1cc(C)ncn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3N3O2S/c1-3-18-9(17)16-8(10(11,12)13)19-7-4-6(2)14-5-15-7/h4-5,8H,3H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | FLKWFBKZQZTUID-MRVPVSSYSA-N |
| XLogP | 3.32 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|