C10H12Cl3N3O4 — CID 3093675
ethyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]carbamate (PubChem CID 3093675) has the molecular formula C10H12Cl3N3O4 and a molecular weight of 344.58 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 3093675 |
| Molecular Formula | C10H12Cl3N3O4 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]carbamate |
| SMILES | CCOC(=O)NC(n1cc(C)c(=O)[nH]c1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3N3O4/c1-3-20-9(19)15-7(10(11,12)13)16-4-5(2)6(17)14-8(16)18/h4,7H,3H2,1-2H3,(H,15,19)(H,14,17,18) |
| InChIKey | QGXVEQVSGIIEHE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|