C16H19N3O2S — CID 1408761
(2S)-N-(2-ethoxyphenyl)-2-(6-methylpyrimidin-4-yl)sulfanylpropanamide (PubChem CID 1408761) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2S)-N-(2-ethoxyphenyl)-2-(6-methylpyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(2-ethoxyphenyl)-2-(6-methylpyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 1408761 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2S)-N-(2-ethoxyphenyl)-2-(6-methylpyrimidin-4-yl)sulfanylpropanamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](C)Sc1cc(C)ncn1 |
| InChI | InChI=1S/C16H19N3O2S/c1-4-21-14-8-6-5-7-13(14)19-16(20)12(3)22-15-9-11(2)17-10-18-15/h5-10,12H,4H2,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | DSTWXFBNDMUYSA-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |