C15H17N3O3S — CID 7575913
(2S)-N-(2-ethoxyphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 7575913) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is (2S)-N-(2-ethoxyphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(2-ethoxyphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7575913 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-N-(2-ethoxyphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](C)Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C15H17N3O3S/c1-3-21-12-7-5-4-6-11(12)17-14(20)10(2)22-15-16-9-8-13(19)18-15/h4-10H,3H2,1-2H3,(H,17,20)(H,16,18,19)/t10-/m0/s1 |
| InChIKey | HUNXSSAJZOVSOR-JTQLQIEISA-N |
| XLogP | 2.29 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |