C15H15N3O4S — CID 110379512
methyl 2-[2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate (PubChem CID 110379512) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is methyl 2-[2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate.
| Compound Name | methyl 2-[2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 110379512 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 2-[2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C15H15N3O4S/c1-9(23-15-16-8-7-12(19)18-15)13(20)17-11-6-4-3-5-10(11)14(21)22-2/h3-9H,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | GBAGDEOZKSKHKQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |