C14H14N4O5S — CID 9143973
(2R)-N-(2-methoxy-4-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 9143973) has the molecular formula C14H14N4O5S and a molecular weight of 350.36 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-4-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 9143973 |
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C14H14N4O5S/c1-8(24-14-15-6-5-12(19)17-14)13(20)16-10-4-3-9(18(21)22)7-11(10)23-2/h3-8H,1-2H3,(H,16,20)(H,15,17,19)/t8-/m1/s1 |
| InChIKey | VYQRPARMOVKZHL-MRVPVSSYSA-N |
| XLogP | 1.81 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|