C15H15Cl2N3OS — CID 46304688
N-(3,5-dichlorophenyl)-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide (PubChem CID 46304688) has the molecular formula C15H15Cl2N3OS and a molecular weight of 356.28 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46304688 |
| Molecular Formula | C15H15Cl2N3OS |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1cc(C)ncn1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3OS/c1-3-13(22-14-4-9(2)18-8-19-14)15(21)20-12-6-10(16)5-11(17)7-12/h4-8,13H,3H2,1-2H3,(H,20,21) |
| InChIKey | PRNDDYLLVWOWDO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |