C20H18Cl2N2OS — CID 46301827
N-(3,5-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylbutanamide (PubChem CID 46301827) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylbutanamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46301827 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1cc(C)c2ccccc2n1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N2OS/c1-3-18(20(25)23-15-10-13(21)9-14(22)11-15)26-19-8-12(2)16-6-4-5-7-17(16)24-19/h4-11,18H,3H2,1-2H3,(H,23,25) |
| InChIKey | WDUKXVGRLOOVMG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |