C19H26N4O3S2 — CID 46304710
N-[4-(2-methylpropylsulfamoyl)phenyl]-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide (PubChem CID 46304710) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[4-(2-methylpropylsulfamoyl)phenyl]-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide.
| Compound Name | N-[4-(2-methylpropylsulfamoyl)phenyl]-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46304710 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[4-(2-methylpropylsulfamoyl)phenyl]-2-(6-methylpyrimidin-4-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1cc(C)ncn1)C(=O)Nc1ccc(S(=O)(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-5-17(27-18-10-14(4)20-12-21-18)19(24)23-15-6-8-16(9-7-15)28(25,26)22-11-13(2)3/h6-10,12-13,17,22H,5,11H2,1-4H3,(H,23,24) |
| InChIKey | AACKSXRNWGIYBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |